CAS 117279-73-9
:Israpafant
Description:
Israpafant, with the CAS number 117279-73-9, is a chemical compound that functions primarily as a selective antagonist of the platelet-activating factor (PAF) receptor. This compound is notable for its potential therapeutic applications, particularly in the treatment of various inflammatory conditions and diseases associated with excessive platelet activation. Israpafant exhibits a unique mechanism of action by blocking the effects of PAF, a potent phospholipid mediator involved in numerous physiological and pathological processes, including inflammation, allergy, and thrombosis. The compound is characterized by its ability to modulate immune responses and has been studied for its efficacy in conditions such as asthma and cardiovascular diseases. In terms of its chemical structure, Israpafant features specific functional groups that contribute to its receptor-binding properties. Overall, Israpafant represents a significant area of interest in pharmacological research, particularly in the context of developing targeted therapies for inflammatory and thrombotic disorders.
Formula:C28H29ClN4S
InChI:InChI=1/C28H29ClN4S/c1-17(2)15-21-11-9-20(10-12-21)13-14-22-16-24-26(23-7-5-6-8-25(23)29)30-18(3)27-32-31-19(4)33(27)28(24)34-22/h5-12,16-18H,13-15H2,1-4H3/t18-/m1/s1
InChI key:InChIKey=RMSWMRJVUJSDGN-UHFFFAOYSA-N
SMILES:CC=1N2C3=C(C(=NC(C)C2=NN1)C4=C(Cl)C=CC=C4)C=C(CCC5=CC=C(CC(C)C)C=C5)S3
Synonyms:- 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 4-(2-chlorophenyl)-6,9-dimethyl-2-[2-[4-(2-methylpropyl)phenyl]ethyl]-
- Israpafant
- 4-(2-chlorophenyl)-6,9-dimethyl-2-{2-[4-(2-methylpropyl)phenyl]ethyl}-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
- 4-(2-Chlorophenyl)-6,9-dimethyl-2-[2-[4-(2-methylpropyl)phenyl]ethyl]-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
- Y 24180
- (6R)-4-(2-chlorophenyl)-6,9-dimethyl-2-{2-[4-(2-methylpropyl)phenyl]ethyl}-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
- 4-(2-Chlorophenyl)-2-[2-(4-isobutylphenyl)ethyl]-6,9-dimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
- 7-(2-chlorophenyl)-9,13-dimethyl-4-[2-[4-(2-methylpropyl)phenyl]ethyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene
- Y-24180;Y24180
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Israpafant
CAS:Israpafant: PAF receptor blocker, IC50 0.84nM, hinders platelet aggregation, eosinophil activation, boosts calcium transit, anti-nephrotoxic.Formula:C28H29ClN4SColor and Shape:SolidMolecular weight:489.07Israpafant
CAS:Controlled Product<p>Israpafant is a prodrug that is hydrolyzed to ertapenem, its active form. It inhibits bacterial growth by inhibiting the synthesis of cell wall peptidoglycan. Israpafant also prevents the formation of covalent bonds between lipid molecules and proteins and has been shown to be effective in treating inflammatory bowel disease (IBD). Israpafant is absorbed through the oral cavity, which enhances the absorption of ertapenem into the bloodstream. The absorption enhancer is processed by hydrochloric acid and fatty acids in the stomach cavity before it becomes available for use in other areas of the body. Israpafant has a particle size of less than 1 micron; this small particle size allows for an increased surface area with more exposure to hydroxyl groups which are needed for its activation.</p>Formula:C28H29ClN4SPurity:Min. 95%Molecular weight:489.1 g/mol

