CAS 1172854-22-6

4-Pyridinemethanamine, N,3-dimethyl-, hydrochloride (1:2)

Description:

4-Pyridinemethanamine, N,3-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the dimethylamino group enhances its solubility in polar solvents, making it useful in various chemical applications. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it could interact with biological systems, possibly influencing neurotransmitter pathways or other biochemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Pyridinemethanamine, N,3-dimethyl-, hydrochloride is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₈H₁₂N₂·2ClH

InChI: InChI=1S/C8H12N2.2ClH/c1-7-5-10-4-3-8(7)6-9-2;;/h3-5,9H,6H2,1-2H3;2*1H

InChI key: InChIKey=FQEZSZLAFXUFKC-UHFFFAOYSA-N

SMILES: C(NC)C=1C(C)=CN=CC1.Cl

Synonyms:

• 4-Pyridinemethanamine, N,3-dimethyl-, hydrochloride (1:2)

N-methyl-1-(3-methyl-4-pyridinyl)methanamine dihydrochloride

CAS: 1172854-22-6

Formula: C₈H₁₄Cl₂N₂

Purity: 95.0%

Molecular weight: 209.11

Ref: 10-F359042