CAS 1172854-54-4

Formula: C14H24ClN3

InChI: InChI=1S/C14H23N3.ClH/c1-2-3-4-8-11-16-14(15)17-12-13-9-6-5-7-10-13;/h5-7,9-10H,2-4,8,11-12H2,1H3,(H3,15,16,17);1H

InChI key: UMIOAATZOCKZTH-UHFFFAOYSA-N

SMILES: CCCCCCNC(=NCC1=CC=CC=C1)N.Cl

NS-3-008 hydrochloride

CAS: 1172854-54-4

NS-3-008 hydrochloride

Formula: C₁₄H₂₄ClN₃

Purity: ≥98%

Molecular weight: 269.81

Ref: 54-BUP10834

NS-3-008 HCl

CAS: 1172854-54-4

Formula: C₁₄H₂₄ClN₃

Purity: 99%

Molecular weight: 269.8135

Ref: IN-DA01KKG7

1-Benzyl-3-Hexylguanidine Hydrochloride

CAS: 1172854-54-4

1-Benzyl-3-Hexylguanidine Hydrochloride

Formula: C₁₄H₂₄ClN₃

Purity: 99%

Molecular weight: 269.81

Ref: 54-OR1023221

NS-3-008 HCl

CAS: 1172854-54-4

1-Benzyl-3-hexylguanidine hydrochloride

Formula: C₁₄H₂₄ClN₃

Purity: 99%

Molecular weight: 269.81

Ref: IN-DG01200126

NS-3-008 hydrochloride

CAS: 1172854-54-4

NS-3-008 hydrochloride (NS-3-008 HCl) is a transcriptional G0/G1 switch 2 (G0s2) inhibitor( IC50 of 2.25 μM).

Formula: C₁₄H₂₄ClN₃

Purity: 99.56%

Color and Shape: Solid

Molecular weight: 269.81

Ref: TM-T8494

1-BENZYL-3-HEXYLGUANIDINE HYDROCHLORIDE

CAS: 1172854-54-4

Purity: 99%

Molecular weight: 269.8200073

Ref: 10-F798232

Ns-3-008 hydrochloride

CAS: 1172854-54-4

Ns-3-008 hydrochloride is a synthetic research compound, which is derived from laboratory-based chemical synthesis. It acts primarily as an inhibitor of specific biological targets, potentially interfering with cellular signaling pathways. The mode of action of Ns-3-008 hydrochloride often involves binding to and inhibiting key enzymes or receptors that play critical roles in disease-related processes.

Formula: C₁₄H₂₄ClN₃

Purity: Min. 95%

Molecular weight: 269.81 g/mol

Ref: 3D-XWB85454