CymitQuimica logo

CAS 117292-47-4

:

3,6,9,12-Tetraoxapentacosanoic acid, sodium salt (1:1)

Description:
3,6,9,12-Tetraoxapentacosanoic acid, sodium salt (1:1) is a synthetic compound characterized by its long-chain structure, which includes multiple ether linkages due to the presence of four oxygen atoms in its backbone. This compound is a sodium salt, indicating that it is the sodium ion form of the corresponding acid, which enhances its solubility in water. The presence of multiple oxygen atoms contributes to its potential as a surfactant or emulsifying agent, making it useful in various applications, including pharmaceuticals, cosmetics, and industrial processes. The long hydrocarbon chain provides hydrophobic characteristics, while the ionic nature of the sodium salt imparts hydrophilicity, allowing for interactions with both polar and non-polar substances. This dual nature can facilitate the formation of micelles or other structures in solution, enhancing its utility in formulations. Additionally, the compound may exhibit stability under a range of pH conditions, making it versatile for different environments. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C21H42O6·Na
InChI:InChI=1S/C21H42O6.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-24-14-15-25-16-17-26-18-19-27-20-21(22)23;/h2-20H2,1H3,(H,22,23);
InChI key:InChIKey=DFEHRQVKXOPBEJ-UHFFFAOYSA-N
SMILES:C(OCCOCCCCCCCCCCCCC)COCCOCC(O)=O.[Na]
Synonyms:
  • Sodium triethylene glycol tridecyl ether acetate
  • 3,6,9,12-Tetraoxapentacosanoic acid, sodium salt (1:1)
  • 3,6,9,12-Tetraoxapentacosanoic acid, sodium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.