CAS 117296-93-2
:1-[2-(Chloromethyl)phenyl]-1H-imidazole
Description:
1-[2-(Chloromethyl)phenyl]-1H-imidazole, with the CAS number 117296-93-2, is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloromethyl group attached to a phenyl ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the chloromethyl group can facilitate nucleophilic substitution reactions, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The imidazole moiety is known for its biological activity, often acting as a pharmacophore in drug design. Additionally, the compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its specific interactions and reactivity can be influenced by the electronic effects of the substituents on the phenyl ring and the imidazole nitrogen atoms. Overall, this compound is of interest for further research in chemical synthesis and potential therapeutic applications.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c11-7-9-3-1-2-4-10(9)13-6-5-12-8-13/h1-6,8H,7H2
InChI key:InChIKey=GDGIPWLHSXOMOZ-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(C=CC=C1)N2C=CN=C2
Synonyms:- 1H-Imidazole, 1-[2-(chloromethyl)phenyl]-
- 1-[2-(Chloromethyl)phenyl]-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
