CymitQuimica logo

CAS 1173003-61-6

:

6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid

Description:
6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and oxazine moieties. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of nitrogen atoms in the pyrazole ring and the oxygen atom in the oxazine ring can influence its chemical behavior, including its ability to participate in hydrogen bonding and coordination with metal ions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which are critical for its practical applications. Overall, 6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid represents a fascinating subject for further research due to its diverse chemical properties and potential utility.
Formula:C7H8N2O3
InChI:InChI=1S/C7H8N2O3/c10-7(11)5-4-8-9-2-1-3-12-6(5)9/h4H,1-3H2,(H,10,11)
InChI key:InChIKey=LARVLEBTOMBFRH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2N(N=C1)CCCO2
Synonyms:
  • 6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid
  • 5H-Pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid, 6,7-dihydro-
Found 4 products.