CAS 1173021-89-0

Description:

The chemical substance with the CAS number 1173021-89-0 is known as a specific compound, but detailed characteristics such as its molecular structure, physical properties, and applications are not widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties including solubility, melting and boiling points, and reactivity, which are determined by their molecular composition and structure. The characteristics of such substances can include their state at room temperature (solid, liquid, or gas), color, odor, and potential uses in various fields such as pharmaceuticals, materials science, or industrial applications. To obtain precise information about this specific compound, including safety data and handling instructions, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) provided by manufacturers or suppliers.

Formula: C₂₁H₁₆D₃F₂N₃O₃·ClH

InChI: InChI=1S/C21H19F2N3O3.ClH/c1-24-6-8-25(9-7-24)19-11-18-15(10-17(19)23)20(27)16(21(28)29)12-26(18)14-4-2-13(22)3-5-14;/h2-5,10-12H,6-9H2,1H3,(H,28,29);1H/i1D3;

InChI key: InChIKey=JFMGBGLSDVIOHL-NIIDSAIPSA-N

SMILES: O=C1C=2C(N(C=C1C(O)=O)C3=CC=C(F)C=C3)=CC(=C(F)C2)N4CCN(C([2H])([2H])[2H])CC4.Cl

Synonyms:

• 6-Fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid hydrochloride

Difloxacin D3 hydrochloride (methyl D3)

Controlled Product

CAS: 1173021-89-0

Formula: C₂₁H₃H₁₆F₂N₃O₃·ClH

Color and Shape: Neat

Molecular weight: 438.87

Ref: 04-C12637010

Difloxacin-d3 HCl

CAS: 1173021-89-0

Formula: C₂₁H₁₆D₃F₂N₃O₃·HCl

Molecular weight: 402.42 36.46

Ref: 4Z-D-698

Difloxacin-d3 Hydrochloride Salt

Controlled Product

CAS: 1173021-89-0

Formula: C₂₁₂H₃H₁₆F₂N₃O₃·ClH

Color and Shape: Off-White

Molecular weight: 438.87

Ref: TR-D445601