
CAS 1173023-52-3
:Ethanone, 2-[(4,5-dihydro-2-thiazolyl)thio]-1-(3,4-dihydroxyphenyl)-, hydrochloride (1:1)
Description:
Ethanone, 2-[(4,5-dihydro-2-thiazolyl)thio]-1-(3,4-dihydroxyphenyl)-, hydrochloride (1:1), identified by CAS number 1173023-52-3, is a chemical compound characterized by its thiazole and phenolic functional groups. This compound features a thiazole ring, which contributes to its potential biological activity, and a phenolic moiety that may enhance its solubility and reactivity. The hydrochloride form indicates that it is a salt, which typically improves stability and solubility in aqueous solutions. The presence of hydroxyl groups on the phenyl ring suggests potential for hydrogen bonding and increased polarity, which can influence its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, pharmacokinetics, and therapeutic applications would require further investigation through experimental studies and literature review. Overall, the structural features of this compound suggest it could play a role in drug development or other chemical applications.
Formula:C11H11NO3S2·ClH
InChI:InChI=1S/C11H11NO3S2.ClH/c13-8-2-1-7(5-9(8)14)10(15)6-17-11-12-3-4-16-11;/h1-2,5,13-14H,3-4,6H2;1H
InChI key:InChIKey=ZZAVDVMJZKDBIB-UHFFFAOYSA-N
SMILES:C(CSC1=NCCS1)(=O)C2=CC(O)=C(O)C=C2.Cl
Synonyms:- Ethanone, 2-[(4,5-dihydro-2-thiazolyl)thio]-1-(3,4-dihydroxyphenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.