CAS 117309-39-4
:N-(2-Chlorophenyl)-N-(phenylsulfonyl)glycine
Description:
N-(2-Chlorophenyl)-N-(phenylsulfonyl)glycine, with the CAS number 117309-39-4, is a chemical compound characterized by its unique structure that includes a glycine moiety substituted with a 2-chlorophenyl group and a phenylsulfonyl group. This compound typically exhibits properties associated with both amino acids and sulfonyl compounds, which may influence its solubility, reactivity, and potential biological activity. It is often studied in the context of medicinal chemistry due to its potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as a lead compound in the development of therapeutic agents. The presence of the sulfonyl group may enhance its interaction with biological targets, while the chlorophenyl group can affect its lipophilicity and overall pharmacokinetic profile. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be consulted when working with this compound in a laboratory setting.
Formula:C14H12ClNO4S
InChI:InChI=1S/C14H12ClNO4S/c15-12-8-4-5-9-13(12)16(10-14(17)18)21(19,20)11-6-2-1-3-7-11/h1-9H,10H2,(H,17,18)
InChI key:InChIKey=TWTQLZIRPFSPNO-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CC=C1)(CC(O)=O)C2=C(Cl)C=CC=C2
Synonyms:- N-(2-Chlorophenyl)-N-(phenylsulfonyl)glycine
- NSC 626990
- Glycine, N-(2-chlorophenyl)-N-(phenylsulfonyl)-
- 2-[N-(Benzenesulfonyl)-2-chloroanilino]acetic acid
- [Benzenesulfonyl-(2-chloro-phenyl)-amino]-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.