CymitQuimica logo

CAS 117309-41-8

:

2-[4-CHLORO(PHENYLSULFONYL)ANILINO]ACETIC ACID

Description:
2-[4-Chloro(phenylsulfonyl)anilino]acetic acid, with the CAS number 117309-41-8, is a chemical compound characterized by its complex structure, which includes an aniline derivative and a sulfonyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it a potential candidate for various chemical reactions and applications. The presence of the chloro substituent enhances its reactivity, while the phenylsulfonyl group contributes to its solubility and stability in different solvents. It is often studied for its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit anti-inflammatory or analgesic properties. The compound's molecular structure allows for interactions with biological targets, which can be explored in drug development. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including functional group transformations and purification methods. Overall, 2-[4-chloro(phenylsulfonyl)anilino]acetic acid represents a significant compound in the realm of pharmaceutical research and development.
Formula:C14H11ClNO4S
InChI:InChI=1/C14H12ClNO4S/c15-11-6-8-12(9-7-11)16(10-14(17)18)21(19,20)13-4-2-1-3-5-13/h1-9H,10H2,(H,17,18)/p-1
SMILES:c1ccc(cc1)S(=O)(=O)N(CC(=O)[O-])c1ccc(cc1)Cl
Synonyms:
  • glycine, N-(4-chlorophenyl)-N-(phenylsulfonyl)-
  • N-(4-chlorophenyl)-N-(phenylsulfonyl)glycine
  • [(4-Chlorophenyl)(Phenylsulfonyl)Amino]Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.