CAS 117309-42-9

N-(4-Fluorophenyl)-N-(phenylsulfonyl)glycine

Description:

N-(4-Fluorophenyl)-N-(phenylsulfonyl)glycine, with the CAS number 117309-42-9, is an organic compound characterized by its unique functional groups and structural features. It contains a glycine backbone, which is an amino acid, modified by the presence of a 4-fluorophenyl group and a phenylsulfonyl moiety. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the fluorine atom may enhance lipophilicity and metabolic stability, while the sulfonyl group can contribute to the compound's reactivity and binding properties. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in drug discovery and development. As with many sulfonamide derivatives, it may also possess antibacterial or anti-inflammatory properties, warranting investigation into its therapeutic potential.

Formula: C₁₄H₁₂FNO₄S

InChI: InChI=1S/C14H12FNO4S/c15-11-6-8-12(9-7-11)16(10-14(17)18)21(19,20)13-4-2-1-3-5-13/h1-9H,10H2,(H,17,18)

InChI key: InChIKey=OQMQAQIMIHSBRB-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=CC=C1)(CC(O)=O)C2=CC=C(F)C=C2

Synonyms:

• Glycine, N-(4-fluorophenyl)-N-(phenylsulfonyl)-
• NSC 626993
• 2-[N-(Benzenesulfonyl)-4-fluoroanilino]acetic acid
• N-(4-Fluorophenyl)-N-(phenylsulfonyl)glycine
• [Benzenesulfonyl-(4-fluoro-phenyl)-amino]-acetic acid