
CAS 117309-81-6
:5′-Cytidylic acid, 5-ethyl-, diammonium salt
Description:
5′-Cytidylic acid, 5-ethyl-, diammonium salt, identified by its CAS number 117309-81-6, is a synthetic derivative of cytidine, a nucleoside that plays a crucial role in cellular metabolism and the synthesis of RNA. This compound features an ethyl group at the 5' position of the cytidine moiety, which can influence its biological activity and solubility. The presence of diammonium salt indicates that the compound has two ammonium groups, enhancing its solubility in aqueous environments and potentially affecting its interaction with biological systems. Typically, such modifications can alter the pharmacokinetics and pharmacodynamics of nucleotides, making them useful in various biochemical applications, including as intermediates in nucleotide synthesis or as potential therapeutic agents. The structural modifications may also impact its stability, reactivity, and ability to participate in enzymatic reactions. Overall, this compound exemplifies the diverse nature of nucleic acid derivatives and their significance in biochemistry and molecular biology.
Formula:C11H18N3O8P·2H3N
InChI:InChI=1S/C11H18N3O8P.2H3N/c1-2-5-3-14(11(17)13-9(5)12)10-8(16)7(15)6(22-10)4-21-23(18,19)20;;/h3,6-8,10,15-16H,2,4H2,1H3,(H2,12,13,17)(H2,18,19,20);2*1H3/t6-,7-,8-,10-;;/m1../s1
InChI key:InChIKey=MVYJCXVWJRCCPH-VJILDTERSA-N
SMILES:O[C@H]1[C@@H](O[C@H](COP(=O)(O)O)[C@H]1O)N2C=C(CC)C(N)=NC2=O.N
Synonyms:- 5′-Cytidylic acid, 5-ethyl-, diammonium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
