CAS 1173097-77-2

Description:

The chemical substance with the CAS number 1173097-77-2 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. Additionally, the compound may exhibit specific biological activities or applications, depending on its functional groups and overall structure. For precise characteristics, including safety data, toxicity, and potential uses, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive information about the substance. If you have access to a chemical database or scientific resources, you can obtain detailed insights into its properties and applications.

Formula: C₁₅H₅Cl₂D₈N₅·ClH

InChI: InChI=1S/C15H13Cl2N5.ClH/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;/h1-10H,(H3,18,21,22);1H/i1D,2D,3D,4D,5D,6D,7D,8D;

InChI key: InChIKey=LTWIBTYLSRDGHP-AGHVBCBTSA-N

SMILES: C(=NNC(NN=CC1=C(C(=C(Cl)C(=C1[2H])[2H])[2H])[2H])=N)C2=C(C(=C(Cl)C(=C2[2H])[2H])[2H])[2H].Cl

Synonyms:

• 1,3-Bis[(4-chloro-2,3,5,6-tetradeuteriophenyl)methylideneamino]guanidine hydrochloride

Robenidene-d8 HCl[bis(phenyl-d4)]

CAS: 1173097-77-2, 25875-50-7

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 378.72

Ref: 3U-D7131

Robenidine D8 hydrochloride

Controlled Product

CAS: 1173097-77-2

Formula: C₁₅H₈H₅Cl₂N₅·ClH

Color and Shape: Neat

Molecular weight: 378.71

Ref: 04-CA16815401

Robenidine-d8 HCl [Bis(phenyl-d4)]

Controlled Product

CAS: 1173097-77-2

Stability Hygroscopic
Applications Robenidine-d8 HCl [bis(phenyl-d4)] (CAS# 1173097-77-2) is a useful isotopically labeled research compound.

Formula: C₁₅₂H₈H₅Cl₂N₅·ClH

Color and Shape: Off-White

Molecular weight: 378.71

Ref: TR-R639001