
CAS 1173103-84-8
:5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine
Description:
5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features multiple functional groups, including methyl and methylthio groups, as well as a phenylsulfonyl moiety, contributing to its potential reactivity and biological activity. The presence of the sulfonyl group often enhances solubility and can influence the compound's interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. The molecular structure suggests that it may engage in various intermolecular interactions, such as hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, the compound's stability, solubility, and lipophilicity are crucial for its application in medicinal chemistry. Overall, 5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine represents a class of compounds that may hold promise in drug development and therapeutic applications.
Formula:C15H15N3O2S2
InChI:InChI=1S/C15H15N3O2S2/c1-10-9-11(2)18-14(16-10)13(15(17-18)21-3)22(19,20)12-7-5-4-6-8-12/h4-9H,1-3H3
InChI key:InChIKey=KSAUCBGUWGWPDL-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C2N(N=C1SC)C(C)=CC(C)=N2)C3=CC=CC=C3
Synonyms:- 3-Benzenesulfonyl-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidine
- 5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine
- Pyrazolo[1,5-a]pyrimidine, 5,7-dimethyl-2-(methylthio)-3-(phenylsulfonyl)-
- AVN 211
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AVN-211
CAS:AVN-211 (CD-008-0173) is a novel and highly selective 5-HT6 receptor small molecule antagonist for the treatment of Alzheimer's disease.Formula:C15H15N3O2S2Color and Shape:SolidMolecular weight:333.43
