CAS 1173103-84-8: 5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine

Description:5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features multiple functional groups, including methyl and methylthio groups, as well as a phenylsulfonyl moiety, contributing to its potential reactivity and biological activity. The presence of the sulfonyl group often enhances solubility and can influence the compound's interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. The molecular structure suggests that it may engage in various intermolecular interactions, such as hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, the compound's stability, solubility, and lipophilicity are crucial for its application in medicinal chemistry. Overall, 5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine represents a class of compounds that may hold promise in drug development and therapeutic applications.

Formula:C₁₅H₁₅N₃O₂S₂

InChI:InChI=1S/C15H15N3O2S2/c1-10-9-11(2)18-14(16-10)13(15(17-18)21-3)22(19,20)12-7-5-4-6-8-12/h4-9H,1-3H3

InChI key:InChIKey=KSAUCBGUWGWPDL-UHFFFAOYSA-N

SMILES:O=S(=O)(C=1C=CC=CC1)C=2C(=NN3C2N=C(C=C3C)C)SC

Synonyms:
3-Benzenesulfonyl-5,7-dimethyl-2-methylsulfanylpyrazolo[1,5-a]pyrimidine
5,7-Dimethyl-2-(methylthio)-3-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidine
Pyrazolo[1,5-a]pyrimidine, 5,7-dimethyl-2-(methylthio)-3-(phenylsulfonyl)-
AVN 211

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	AVN-211 REF: TM-T30230CAS: 1173103-84-8	- - -	1,444.00 €~2,375.00 €	Tue 22 Apr 25
	3-Sulfonyl-pyrazolo(1,5-A)pyrimidine REF: 3D-YWB10384CAS: 1173103-84-8	Min. 95%	- - -	Discontinued product