CymitQuimica logo

CAS 1173146-04-7

:

Methyl 4-amino-4,5,6,7-tetrahydro-3-benzofurancarboxylate

Description:
Methyl 4-amino-4,5,6,7-tetrahydro-3-benzofurancarboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amino group. This compound features a tetrahydrobenzofuran ring, indicating it has undergone partial hydrogenation, contributing to its cyclic structure. The presence of the methyl ester functional group suggests it has potential for reactivity typical of esters, such as hydrolysis or transesterification. The amino group can participate in various chemical reactions, including nucleophilic substitutions and can also influence the compound's solubility and polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c1-13-10(12)6-5-14-8-4-2-3-7(11)9(6)8/h5,7H,2-4,11H2,1H3
InChI key:InChIKey=CSWJHXPCPCQYSL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(OC1)CCCC2N
Synonyms:
  • Methyl 4-amino-4,5,6,7-tetrahydro-3-benzofurancarboxylate
  • 3-Benzofurancarboxylic acid, 4-amino-4,5,6,7-tetrahydro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.