CAS 1173147-91-5
:9-Fluoro-2,3-dihydro-3-methyl-10-[4-(methyl-d3)-1-piperazinyl]-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid
Description:
9-Fluoro-2,3-dihydro-3-methyl-10-[4-(methyl-d3)-1-piperazinyl]-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid is a complex organic compound characterized by its unique structural features, including a fluorine atom, a piperazine moiety, and a carboxylic acid functional group. This compound belongs to the class of benzoxazines, which are known for their diverse biological activities. The presence of the fluorine atom often enhances the lipophilicity and metabolic stability of the molecule, potentially influencing its pharmacokinetic properties. The piperazine ring contributes to its ability to interact with biological targets, making it a candidate for pharmaceutical applications. The compound's carboxylic acid group may also play a role in solubility and reactivity. Overall, the intricate structure of this substance suggests potential utility in medicinal chemistry, particularly in the development of therapeutics targeting various diseases. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C18H17D3FN3O4
InChI:InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/i2D3
InChI key:InChIKey=GSDSWSVVBLHKDQ-BMSJAHLVSA-N
SMILES:O=C1C=2C3=C(C(=C(F)C2)N4CCN(C([2H])([2H])[2H])CC4)OCC(C)N3C=C1C(O)=O
Synonyms:- Ofloxacin-d3
- 7H-Pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid, 9-fluoro-2,3-dihydro-3-methyl-10-[4-(methyl-d3)-1-piperazinyl]-7-oxo-
- 9-Fluoro-2,3-dihydro-3-methyl-10-[4-(methyl-d3)-1-piperazinyl]-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ofloxacin-d3
CAS:<p>Ofloxacin-d3 is a deuterated compound of Ofloxacin.</p>Formula:C18H17D3FN3O4Color and Shape:SolidMolecular weight:364.39Ofloxacin D3 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C18H3H17FN3O4Color and Shape:Single SolutionMolecular weight:364.39

