
CAS 117318-92-0
:2-Propenoic acid, 2-methyl-, 6-[(4′-cyano[1,1′-biphenyl]-4-yl)oxy]hexyl ester, homopolymer
Description:
The chemical substance known as "2-Propenoic acid, 2-methyl-, 6-[(4′-cyano[1,1′-biphenyl]-4-yl)oxy]hexyl ester, homopolymer," with the CAS number 117318-92-0, is a synthetic polymer derived from the polymerization of a specific acrylate monomer. This compound features a complex structure that includes a cyano-substituted biphenyl moiety, which contributes to its unique properties, such as enhanced thermal stability and potential applications in electronic materials. The presence of the 2-methyl group and the hexyl ester enhances its solubility and processability. As a homopolymer, it exhibits characteristics typical of acrylic polymers, including good adhesion, flexibility, and resistance to environmental factors. Its applications may span various fields, including coatings, adhesives, and potentially in the development of advanced materials for optoelectronic devices. The polymer's properties can be influenced by factors such as molecular weight, degree of cross-linking, and the specific conditions under which it is synthesized.
Formula:(C23H25NO3)x
InChI:InChI=1S/C23H25NO3/c1-18(2)23(25)27-16-6-4-3-5-15-26-22-13-11-21(12-14-22)20-9-7-19(17-24)8-10-20/h7-14H,1,3-6,15-16H2,2H3
InChI key:InChIKey=JJJGWRPDCQICFP-UHFFFAOYSA-N
SMILES:O(CCCCCCOC(C(C)=C)=O)C1=CC=C(C=C1)C2=CC=C(C#N)C=C2
Synonyms:- 4-[ω-(2-Methylpropenoyloxy)hexyl-oxy]-4′-cyanobiphenyl homopolymer
- Poly[(4-cyanobiphenyl-4′-yloxy)hexyl methacrylate]
- 2-Propenoic acid, 2-methyl-, 6-[(4′-cyano[1,1′-biphenyl]-4-yl)oxy]hexyl ester, homopolymer
- 4′-Cyano-4-(6-methacryloxyhexyl)biphenyl homopolymer
- 6-[4-(4-Cyanophenyl)phenoxy]hexyl methacrylate homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.