CAS 1173188-31-2

Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate

Description:

Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate is a complex organic compound characterized by its unique dibenzo[b,d]pyran structure, which features a fused ring system. This compound contains multiple functional groups, including methoxy groups and a carboxylate ester, contributing to its chemical reactivity and potential biological activity. The presence of the propenyloxy substituent suggests that it may participate in various chemical reactions, such as polymerization or electrophilic addition. Its oxo group indicates potential for keto-enol tautomerism, which can influence its stability and reactivity. The compound's molecular structure may impart specific optical properties, making it of interest in fields such as organic synthesis, medicinal chemistry, or materials science. Additionally, the presence of methoxy groups can enhance solubility in organic solvents and may influence the compound's interaction with biological systems. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research and application in various chemical contexts.

Formula: C₂₀H₁₈O₇

InChI: InChI=1S/C20H18O7/c1-5-10-26-17-13(23-2)8-7-12-15(17)16-11(19(21)25-4)6-9-14(24-3)18(16)27-20(12)22/h5-9H,1,10H2,2-4H3

InChI key: InChIKey=DWNMJAPYGWPHLT-UHFFFAOYSA-N

SMILES: O(CC=C)C1=C2C=3C(=C(OC)C=CC3C(OC)=O)OC(=O)C2=CC=C1OC

Synonyms:

• 6H-Dibenzo[b,d]pyran-1-carboxylic acid, 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-, methyl ester
• Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate

10-O-Allyl-3,8-deshydroxy-9-O-methyl Luteic Acid Methyl Ester

Controlled Product

CAS: 1173188-31-2

Applications Taspine intermediate.

Formula: C₂₀H₁₈O₇

Color and Shape: Neat

Molecular weight: 370.35

Ref: TR-A549900