CAS 1173188-31-2
:Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate
Description:
Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate is a complex organic compound characterized by its unique dibenzo[b,d]pyran structure, which features a fused ring system. This compound contains multiple functional groups, including methoxy groups and a carboxylate ester, contributing to its chemical reactivity and potential biological activity. The presence of the propenyloxy substituent suggests that it may participate in various chemical reactions, such as polymerization or electrophilic addition. Its oxo group indicates potential for keto-enol tautomerism, which can influence its stability and reactivity. The compound's molecular structure may impart specific optical properties, making it of interest in fields such as organic synthesis, medicinal chemistry, or materials science. Additionally, the presence of methoxy groups can enhance solubility in organic solvents and may influence the compound's interaction with biological systems. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research and application in various chemical contexts.
Formula:C20H18O7
InChI:InChI=1S/C20H18O7/c1-5-10-26-17-13(23-2)8-7-12-15(17)16-11(19(21)25-4)6-9-14(24-3)18(16)27-20(12)22/h5-9H,1,10H2,2-4H3
InChI key:InChIKey=DWNMJAPYGWPHLT-UHFFFAOYSA-N
SMILES:O(CC=C)C1=C2C=3C(=C(OC)C=CC3C(OC)=O)OC(=O)C2=CC=C1OC
Synonyms:- 6H-Dibenzo[b,d]pyran-1-carboxylic acid, 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-, methyl ester
- Methyl 4,9-dimethoxy-6-oxo-10-(2-propen-1-yloxy)-6H-dibenzo[b,d]pyran-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
10-O-Allyl-3,8-deshydroxy-9-O-methyl Luteic Acid Methyl Ester
CAS:Controlled ProductApplications Taspine intermediate.
Formula:C20H18O7Color and Shape:NeatMolecular weight:370.35
