CymitQuimica logo

CAS 117320-29-3

:

1-benzyloxy-2-(1,1,2,2,2-pentadeuterioethoxy)benzene

Description:
1-Benzyloxy-2-(1,1,2,2,2-pentadeuterioethoxy)benzene is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a benzyloxy group and an ethoxy group that is fully deuterated. The presence of deuterium, a stable isotope of hydrogen, in the ethoxy group enhances the compound's utility in various applications, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where it can help elucidate molecular dynamics and interactions. The compound's molecular structure contributes to its potential solubility in organic solvents, while its aromatic nature may impart certain stability and reactivity characteristics typical of aromatic compounds. Additionally, the presence of the benzyloxy group can influence the compound's reactivity, making it a candidate for further chemical transformations. Overall, 1-benzyloxy-2-(1,1,2,2,2-pentadeuterioethoxy)benzene serves as a valuable tool in synthetic organic chemistry and analytical applications due to its unique isotopic labeling and structural features.
Formula:C15H11D5O2
InChI:InChI=1/C15H16O2/c1-2-16-14-10-6-7-11-15(14)17-12-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3/i1D3,2D2
SMILES:C(C(Oc1ccccc1OCc1ccccc1)([2H])[2H])([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.