CAS 117324-05-7

ETHYL 2-AMINO-4-FLUOROBENZOATE

Description:

Ethyl 2-amino-4-fluorobenzoate, with the CAS number 117324-05-7, is an organic compound characterized by its ester functional group and the presence of both an amino group and a fluorine atom on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the amino group. The fluorine atom contributes to its unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as fluorinated compounds often exhibit enhanced biological activity. Ethyl 2-amino-4-fluorobenzoate can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as with many chemical substances, it may pose health risks if not managed properly. Overall, its structural features and reactivity profile make it an interesting compound for research and application in various chemical fields.

Formula: C₉H₁₀FNO₂

InChI: InChI=1/C9H10FNO2/c1-2-13-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2,11H2,1H3

SMILES: CCOC(=O)c1ccc(cc1N)F

Synonyms:

• Benzoic Acid, 2-Amino-4-Fluoro-, Ethyl Ester

Ethyl 2-amino-4-fluorobenzoate

CAS: 117324-05-7

Formula: C₉H₁₀FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.1796

Ref: IN-DA000E42

Ethyl 2-amino-4-fluorobenzoate

CAS: 117324-05-7

Ethyl 2-amino-4-fluorobenzoate

Formula: C₉H₁₀FNO₂

Purity: 95%

Color and Shape: faint brown crystalline solid

Molecular weight: 183.18g/mol

Ref: 54-PC201039

Ethyl 2-Amino-4-fluorobenzoate

CAS: 117324-05-7

Formula: C₉H₁₀FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.182

Ref: 10-F066794