CAS 1173266-48-2

1H-Pyrazol-5-amine, 3,3′-(1-methylethylidene)bis[1-ethyl-

Description:

1H-Pyrazol-5-amine, 3,3′-(1-methylethylidene)bis[1-ethyl-] is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amine functional group, indicating the presence of a nitrogen atom bonded to hydrogen, which contributes to its basicity and potential reactivity. The presence of the 1-methylethylidene group suggests that the compound has branching in its structure, which can influence its physical and chemical properties, such as solubility and boiling point. The ethyl substituents further modify its reactivity and steric hindrance. Generally, compounds with such structures may exhibit biological activity, making them of interest in medicinal chemistry. Additionally, the specific arrangement of atoms and functional groups can lead to unique interactions in various chemical environments, potentially affecting their stability and reactivity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₂₂N₆

InChI: InChI=1S/C13H22N6/c1-5-18-11(14)7-9(16-18)13(3,4)10-8-12(15)19(6-2)17-10/h7-8H,5-6,14-15H2,1-4H3

InChI key: InChIKey=ATTLXZNQIDUASP-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=NN(CC)C(N)=C1)C2=NN(CC)C(N)=C2

Synonyms:

• 1H-Pyrazol-5-amine, 3,3′-(1-methylethylidene)bis[1-ethyl-
• 3-[1-(5-Amino-1-ethyl-1H-pyrazol-3-yl)-1-methylethyl]-1-ethyl-1H-pyrazol-5-amine
• 5-[2-(5-Amino-1-ethylpyrazol-3-yl)propan-2-yl]-2-ethylpyrazol-3-amine
• 3-[1-(5-Amino-1-ethylpyrazol-3-yl)-isopropyl]-1-ethylpyrazole-5-ylamine