CAS 117338-23-5
:2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoyl fluoride
Description:
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoyl fluoride is a fluorinated aromatic compound characterized by the presence of multiple fluorine substituents on a benzene ring, specifically at the 2, 3, 5, and 6 positions, along with a trifluoromethyl group at the para position. This compound is notable for its high degree of fluorination, which imparts unique chemical properties such as increased stability, lipophilicity, and potential reactivity in various chemical reactions. The presence of the benzoyl fluoride functional group suggests that it may participate in acylation reactions or serve as a reactive intermediate in organic synthesis. Its fluorinated nature may also enhance its utility in applications such as agrochemicals, pharmaceuticals, or materials science, where fluorinated compounds are often sought for their distinctive properties. Additionally, the compound's structure may influence its physical properties, such as boiling point and solubility, making it of interest in both industrial and research contexts. Safety and handling considerations are essential due to the potential hazards associated with fluorinated compounds.
Formula:C8F8O
InChI:InChI=1/C8F8O/c9-3-1(7(13)17)4(10)6(12)2(5(3)11)8(14,15)16
SMILES:c1(c(c(c(c(c1F)F)C(F)(F)F)F)F)C(=O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoyl fluoride
CAS:2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoyl fluoride
Molecular weight:264.07223g/mol

