
CAS 117343-34-7
:2-[1-Methyl-1-(methylamino)ethyl]phenol
Description:
2-[1-Methyl-1-(methylamino)ethyl]phenol, identified by its CAS number 117343-34-7, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a branched alkyl chain that includes a methylamino group, contributing to its potential biological activity. It is typically a colorless to light yellow liquid or solid, depending on its purity and specific conditions. The presence of both the phenolic and amine functionalities suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility in various solvents. Additionally, the compound may possess moderate to high lipophilicity due to the hydrophobic aromatic ring and alkyl substituents, which can affect its interaction with biological membranes. Its chemical properties may make it relevant in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its full potential and safety profile.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-10(2,11-3)8-6-4-5-7-9(8)12/h4-7,11-12H,1-3H3
InChI key:InChIKey=WEZHJSFDIFQAFL-UHFFFAOYSA-N
SMILES:C(NC)(C)(C)C1=C(O)C=CC=C1
Synonyms:- 2-[2-(Methylamino)propan-2-yl]phenol
- Phenol, 2-[1-methyl-1-(methylamino)ethyl]-
- 2-[1-Methyl-1-(methylamino)ethyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.