CAS 117344-32-8
:4,4'-(9-fluorenylidene)bis(2-phenoxy-ethanol)
Description:
4,4'-(9-fluorenylidene)bis(2-phenoxy-ethanol), with the CAS number 117344-32-8, is an organic compound characterized by its unique molecular structure, which features a central 9-fluorenylidene moiety linked to two 2-phenoxy-ethanol groups. This compound exhibits properties typical of both aromatic and alcohol functionalities, contributing to its potential applications in various fields, including materials science and organic synthesis. The presence of the fluorenylidene group imparts significant stability and rigidity to the molecule, while the phenoxy-ethanol units provide sites for hydrogen bonding and potential reactivity. This compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for studies in photochemistry or as a building block in the development of organic light-emitting diodes (OLEDs). Additionally, its solubility characteristics can be influenced by the phenoxy groups, which may enhance its compatibility with various solvents and matrices in practical applications. Overall, this compound represents a fascinating intersection of structural complexity and functional potential in organic chemistry.
Formula:C29H26O4
InChI:InChI=1/C29H26O4/c30-17-19-32-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)33-20-18-31)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-16,30-31H,17-20H2
SMILES:c1ccc2c(c1)c1ccccc1C2(c1ccc(cc1)OCCO)c1ccc(cc1)OCCO
Synonyms:- Bisphenoxyethanolfluorene
- 9,9-Bis[4-(2-Hydroxyethoxy)Phenyl]Fluorene
- 4,4'-(9-Fluorenylidene)bis(2-phenoxyethanol)
- 2,2'-[9H-fluorene-9,9-diylbis(benzene-4,1-diyloxy)]diethanol
- Bpef
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9,9-Bis[4-(2-hydroxyethoxy)phenyl]fluorene
CAS:Formula:C29H26O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:438.52Ethanol, 2,2'-[9H-fluoren-9-ylidenebis(4,1-phenyleneoxy)]bis-
CAS:Formula:C29H26O4Purity:97%Color and Shape:SolidMolecular weight:438.5143Bisphenoxyethanolfluorene
CAS:<p>Bisphenoxyethanolfluorene</p>Purity:≥98%Molecular weight:438.51g/molRef: 54-BUP16994
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire200mgTo inquireBisphenoxyethanolfluorene
CAS:<p>Bisphenoxyethanolfluorene: stable, used for synthesizing heat-resistant, transparent, high-refractive polymers.</p>Formula:C29H26O4Purity:98.96% - 99.60%Color and Shape:SolidMolecular weight:438.51Bisphenoxyethanolfluorene
CAS:<p>Bisphenoxyethanolfluorene is a viscosity-increasing agent that belongs to the class of drugs known as prostaglandin inhibitors. It is used in animal health for the treatment of chronic bronchitis, glaucoma and other diseases. Bisphenoxyethanolfluorene inhibits the production of prostaglandins, which are mediators that are responsible for inflammation and pain. This drug also has an effect on the release of chloride ions from cells, which may be due to its ability to interact with the hydroxyl group present in bisphenoxyethanolfluorene. The molecular skeleton of bisphenoxyethanolfluorene consists of two benzene rings joined by an ethylene bridge. The chlorine atom attached to one ring forms a polarizability interaction with hydrogen atoms on adjacent molecules, while forming a strong intramolecular hydrogen bond with another chlorine atom on adjacent molecules. This interaction leads to increased</p>Formula:C29H26O4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:438.51 g/mol





