CAS 1173706-35-8
:N-Octylnortadalafil
Description:
N-Octylnortadalafil is a synthetic compound that belongs to the class of phosphodiesterase type 5 (PDE5) inhibitors, which are primarily used in the treatment of erectile dysfunction. This substance is a derivative of tadalafil, a well-known medication that enhances blood flow by inhibiting the breakdown of cyclic guanosine monophosphate (cGMP). N-Octylnortadalafil features a long alkyl chain, which may influence its pharmacokinetic properties, such as solubility and absorption. The compound is characterized by its ability to selectively target the PDE5 enzyme, leading to vasodilation and increased blood flow to specific areas of the body. Its chemical structure includes functional groups that contribute to its biological activity and stability. As with other PDE5 inhibitors, potential side effects may include headaches, flushing, and gastrointestinal disturbances. Research into N-Octylnortadalafil may focus on its efficacy, safety profile, and potential applications in various therapeutic areas beyond erectile dysfunction.
Formula:C29H33N3O4
InChI:InChI=1S/C29H33N3O4/c1-2-3-4-5-6-9-14-31-17-26(33)32-23(29(31)34)16-21-20-10-7-8-11-22(20)30-27(21)28(32)19-12-13-24-25(15-19)36-18-35-24/h7-8,10-13,15,23,28,30H,2-6,9,14,16-18H2,1H3/t23-,28-/m1/s1
InChI key:InChIKey=JIMWYJMUPCVOFA-QDPGVEIFSA-N
SMILES:O=C1N2[C@@H](C3=C(C=4C(N3)=CC=CC4)C[C@@]2(C(=O)N(CCCCCCCC)C1)[H])C=5C=C6C(=CC5)OCO6
Synonyms:- (6R,12aR)-6-(1,3-Benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-octylpyrazino[1′,2′:1,6]pyrido[3,4-b]indole-1,4-dione
- N-Octyltadalafil
- N-Octylnortadalafil
- Pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-1,4-dione, 6-(1,3-benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-octyl-, (6R,12aR)-
- N-Octyl Nortadalafil
- (6R,12aR)-6-(1,3-Benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-octylpyrazino[1',2':1,6]pyrido[3,4-b]indole-1,4-dione
- Pyrazino[1',2':1,6]pyrido[3,4-b]indole-1,4-dione, 6-(1,3-benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-octyl-, (6R,12aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-Octyl-Nortadalafil
CAS:Formula:C29H33N3O4Color and Shape:White To Off-White SolidMolecular weight:487.60N-Octyl Nortadalafil
CAS:Controlled ProductApplications Tadalafil (T004500) analog which is a phosphodiesterase 5 inhibitor.
References Jiru, M., et al.: J. Pharm. Biomed. Anal., 164, 713-724 (2019)Formula:C29H33N3O4Color and Shape:White To Off-WhiteMolecular weight:487.59


