CymitQuimica logo

CAS 1173721-46-4

:

5-Bromo-1-ethyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione

Description:
5-Bromo-1-ethyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a bromine atom at the 5-position and an ethyl group at the 1-position contributes to its chemical reactivity and solubility properties. This compound features two carbonyl groups, which are indicative of its diketone functionality, enhancing its potential for various chemical reactions, including nucleophilic additions and condensation reactions. The molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its CAS number, 1173721-46-4, facilitates its identification in chemical databases and literature. The compound's stability, solubility in organic solvents, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations for its practical applications in research and industry.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-2-12-8-6(7(13)9(12)14)3-5(10)4-11-8/h3-4H,2H2,1H3
InChI key:InChIKey=SLXHZHUPVBMYJB-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(C(=O)C1=O)=CC(Br)=CN2
Synonyms:
  • 5-Bromo-1-ethyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione
  • 1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 5-bromo-1-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.