CAS 117377-38-5
:3-Amino-5-(ethylamino)-4-isothiazolecarbonitrile
Description:
3-Amino-5-(ethylamino)-4-isothiazolecarbonitrile is a heterocyclic compound characterized by the presence of an isothiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features an amino group and an ethylamino substituent, contributing to its potential reactivity and biological activity. The carbonitrile functional group enhances its polarity and can influence its solubility in various solvents. Typically, compounds like this may exhibit properties such as moderate to high melting points, depending on their molecular interactions and crystal structure. The presence of multiple functional groups suggests potential applications in pharmaceuticals or agrochemicals, where such structures may serve as intermediates or active ingredients. Additionally, the compound's unique structure may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which could be relevant in materials science or organic electronics.
Formula:C6H8N4S
InChI:InChI=1S/C6H8N4S/c1-2-9-6-4(3-7)5(8)10-11-6/h9H,2H2,1H3,(H2,8,10)
InChI key:InChIKey=BEURHOAFQKHNNQ-UHFFFAOYSA-N
SMILES:N(CC)C1=C(C#N)C(N)=NS1
Synonyms:- 4-Isothiazolecarbonitrile, 3-amino-5-(ethylamino)-
- 3-Amino-5-(ethylamino)-4-isothiazolecarbonitrile
- 3-Amino-5-(ethylamino)-1,2-thiazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
