
CAS 117377-80-7
:4-(2-Azidoethyl)pyridine
Description:
4-(2-Azidoethyl)pyridine is an organic compound characterized by the presence of a pyridine ring substituted with an azidoethyl group. The azido group (-N3) is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is soluble in polar organic solvents, which facilitates its use in various chemical reactions. The presence of the pyridine moiety contributes to its basicity and potential for coordination with metal ions. Additionally, 4-(2-Azidoethyl)pyridine can participate in nucleophilic substitution reactions due to the azido group, making it valuable in synthetic organic chemistry. However, it should be handled with care due to the potential hazards associated with azides, including their explosive nature under certain conditions. Proper safety protocols should be followed when working with this compound in a laboratory setting.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-11-10-6-3-7-1-4-9-5-2-7/h1-2,4-5H,3,6H2
InChI key:InChIKey=FXJZRDQREHTBKN-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])C=1C=CN=CC1
Synonyms:- Pyridine, 4-(2-azidoethyl)-
- 4-(2-Azidoethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
