
CAS 1173807-85-6
:Cyclopropanecarboxylic acid, 1-amino-2-ethenyl-, ethyl ester, (1R,2S)-, sulfate (2:1)
Description:
Cyclopropanecarboxylic acid, 1-amino-2-ethenyl-, ethyl ester, (1R,2S)-, sulfate (2:1) is a chemical compound characterized by its unique cyclopropane ring structure, which contributes to its reactivity and stability. The presence of an amino group and an ethyl ester functional group indicates potential for various chemical interactions, including nucleophilic substitutions and esterification reactions. The sulfate moiety suggests that this compound may exhibit properties typical of sulfates, such as increased solubility in water and potential for ionic interactions. The (1R,2S) stereochemistry indicates specific spatial arrangements of atoms, which can influence the compound's biological activity and reactivity. This compound may be of interest in pharmaceutical applications due to its structural features, which could lead to specific interactions with biological targets. Overall, its unique combination of functional groups and stereochemistry makes it a compound of interest in both synthetic and medicinal chemistry.
Formula:C8H13NO2H2O4S
InChI:InChI=1S/C8H13NO2.H2O4S/c1-3-6-5-8(6,9)7(10)11-4-2;1-5(2,3)4/h3,6H,1,4-5,9H2,2H3;(H2,1,2,3,4)/t6-,8-;/m1./s1
InChI key:InChIKey=IRSDSHMMOLKACP-CIRBGYJCSA-N
SMILES:C(OCC)(=O)[C@]1(N)[C@H](C=C)C1.S(=O)(=O)(O)O
Synonyms:- Cyclopropanecarboxylic acid, 1-amino-2-ethenyl-, ethyl ester, (1R,2S)-, sulfate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2S)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate hemisulfate
CAS:Formula:C8H13NO2Molecular weight:155.1943
