
CAS 117390-41-7
:Thieno[3,2-b]pyridine-6-carboxamide
Description:
Thieno[3,2-b]pyridine-6-carboxamide is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxamide functional group, enhancing its potential for hydrogen bonding and interactions with biological targets. It typically exhibits moderate solubility in polar solvents due to the presence of the carboxamide group, while its aromatic nature may confer stability and influence its reactivity. Thieno[3,2-b]pyridine derivatives are of interest in medicinal chemistry, often investigated for their biological activities, including potential anti-inflammatory, anti-cancer, and anti-viral properties. The compound's structure allows for various substitutions, which can further modify its pharmacological profile. Additionally, its molecular geometry and electronic characteristics can be studied using computational methods to predict interactions with biological macromolecules. Overall, Thieno[3,2-b]pyridine-6-carboxamide represents a valuable scaffold in drug discovery and development, with ongoing research aimed at elucidating its mechanisms of action and therapeutic potential.
Formula:C8H6N2OS
InChI:InChI=1S/C8H6N2OS/c9-8(11)5-3-7-6(10-4-5)1-2-12-7/h1-4H,(H2,9,11)
InChI key:InChIKey=UHADCXYRFWNAIW-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=C2C(=NC1)C=CS2
Synonyms:- Thieno[3,2-b]pyridine-6-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.