CAS 117391-50-1
:DL-beta-(3-Bromophenyl)alanine
Description:
DL-beta-(3-Bromophenyl)alanine, with the CAS number 117391-50-1, is an amino acid derivative characterized by the presence of a bromophenyl group at the beta position of the alanine structure. This compound features both a carboxylic acid group and an amino group, typical of amino acids, which allows it to participate in various biochemical reactions. The bromine substituent on the phenyl ring can influence the compound's reactivity and interactions, potentially affecting its biological activity. As a chiral molecule, it exists in two enantiomeric forms, which may exhibit different properties and biological effects. The presence of the bromine atom can enhance lipophilicity and alter the compound's solubility in different solvents. DL-beta-(3-Bromophenyl)alanine is often used in research settings, particularly in studies related to protein synthesis, enzyme activity, and as a building block in the synthesis of more complex molecules. Its unique structural features make it a valuable compound in medicinal chemistry and pharmacological studies.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c10-7-3-1-2-6(4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1
SMILES:c1cc(cc(c1)Br)[C@H](CC(=O)O)N
Synonyms:- Bio-Farma Bf000138
- Dl-3-Amino-3-(3-Bromo-Phenyl)-Propionic Acid
- 3-(3-Bromophenyl)-Beta-Alanine
- 3-Amino-3-(3-Bromophenyl)Propanoic Acid
- 3-Amino-3-(3-Bromo-Phenyl)-Propionic Acid
- Rarechem Ak Hc T307
- DL-(3-Bromophenyl)alanine
- (3R)-3-amino-3-(3-bromophenyl)propanoic acid
- (3S)-3-amino-3-(3-bromophenyl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzenepropanoic acid, β-amino-3-bromo-
CAS:Formula:C9H10BrNO2Purity:97%Color and Shape:SolidMolecular weight:244.08523-Amino-3-(3-bromophenyl)propionic Acid
CAS:Formula:C9H10BrNO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:244.093-Amino-3-(3-bromophenyl)propanoic acid
CAS:3-Amino-3-(3-bromophenyl)propanoic acidFormula:C9H10BrNO2Purity:97%Color and Shape: white solidMolecular weight:244.09g/mol3-Amino-3-(3-bromophenyl)propionic acid
CAS:Versatile small molecule scaffold
Formula:C9H10BrNO2Purity:Min. 95%Molecular weight:244.09 g/mol





