CAS 117391-54-5
:β-Amino-2,4-dimethylbenzenepropanoic acid
Description:
β-Amino-2,4-dimethylbenzenepropanoic acid, also known as a derivative of phenylalanine, is an organic compound characterized by its amino acid structure, which includes both an amino group and a carboxylic acid group. This compound features a benzene ring with two methyl groups at the 2 and 4 positions, contributing to its hydrophobic characteristics. The presence of the propanoic acid moiety indicates that it has a three-carbon chain attached to the benzene, enhancing its solubility in polar solvents. The amino group allows for potential interactions in biological systems, making it relevant in biochemical applications. Its structural features suggest that it may exhibit both hydrophilic and hydrophobic properties, which can influence its behavior in various chemical environments. Additionally, the compound may participate in hydrogen bonding due to the amino and carboxylic acid functional groups, affecting its reactivity and interactions with other molecules. Overall, β-Amino-2,4-dimethylbenzenepropanoic acid is a compound of interest in both synthetic and biological chemistry contexts.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-7-3-4-9(8(2)5-7)10(12)6-11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=LRMMWNSBHJFPEE-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N)C1=C(C)C=C(C)C=C1
Synonyms:- 3-(2,4-Dimethylphenyl)-Beta-Alanine
- 3-Amino-3-(2,4-dimethylphenyl)propanoic acid
- Benzenepropanoic acid, β-amino-2,4-dimethyl-
- Bio-Farma Bf000144
- Rarechem Ak Hc T312
- Vitas-Bb Tbb000103
- β-Amino-2,4-dimethylbenzenepropanoic acid
- 3-Amino-3-(2,4-dimethyl-phenyl)-propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
