CAS 117391-55-6
:β-Amino-2,5-dimethylbenzenepropanoic acid
Description:
β-Amino-2,5-dimethylbenzenepropanoic acid, also known as a derivative of phenylalanine, is an organic compound characterized by the presence of an amino group and a carboxylic acid functional group, which contribute to its classification as an amino acid. This compound features a benzene ring with two methyl substituents at the 2 and 5 positions, along with a propanoic acid chain that includes the amino group at the beta position relative to the carboxylic acid. Its molecular structure suggests it may exhibit both hydrophilic and hydrophobic properties, making it potentially useful in various biochemical applications. The presence of the amino group allows for participation in peptide bond formation, while the aromatic ring may contribute to interactions with other biomolecules. Additionally, the compound's solubility and stability can be influenced by pH and temperature, which are critical factors in its potential applications in pharmaceuticals or as a biochemical reagent. Overall, β-Amino-2,5-dimethylbenzenepropanoic acid represents a unique structure with implications in both synthetic and biological chemistry.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-7-3-4-8(2)9(5-7)10(12)6-11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=ORBDRZAPRLVKDA-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N)C1=C(C)C=CC(C)=C1
Synonyms:- 3-Amino-3-(2,5-dimethylphenyl)propanoic acid
- β-Amino-2,5-dimethylbenzenepropanoic acid
- Benzenepropanoic acid, β-amino-2,5-dimethyl-
- 3-Amino-3-(2,5-dimethyl-phenyl)-propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
