
CAS 1173917-28-6
:2,4-Dichloro-3-pyridineacetic acid
Description:
2,4-Dichloro-3-pyridineacetic acid is a chemical compound characterized by its pyridine ring and acetic acid functional group, which contributes to its potential biological activity. This compound features two chlorine atoms substituted at the 2 and 4 positions of the pyridine ring, enhancing its reactivity and influencing its interaction with biological systems. It is typically a solid at room temperature and is soluble in polar solvents, which facilitates its use in various applications, including as a herbicide or in pharmaceutical research. The presence of the carboxylic acid group allows for potential hydrogen bonding, which can affect its solubility and reactivity. Additionally, the dichloro substitution pattern may impart specific herbicidal properties, making it of interest in agricultural chemistry. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, 2,4-Dichloro-3-pyridineacetic acid represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H5Cl2NO2
InChI:InChI=1S/C7H5Cl2NO2/c8-5-1-2-10-7(9)4(5)3-6(11)12/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=CPIOFPPOSYJKID-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C(Cl)=CC=NC1Cl
Synonyms:- 2,4-Dichloro-3-pyridineacetic acid
- 2-(2,4-Dichloropyridin-3-yl)acetic acid
- 3-Pyridineacetic acid, 2,4-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.