CymitQuimica logo

CAS 1173984-10-5

:

2-Methoxy-4,6-dimethyl-5-pyrimidinamine

Description:
2-Methoxy-4,6-dimethyl-5-pyrimidinamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxy group (-OCH3) and two methyl groups (-CH3) attached to the pyrimidine ring, specifically at positions 2, 4, and 6. The presence of these substituents influences its chemical properties, including solubility, reactivity, and potential biological activity. Typically, compounds of this nature may exhibit moderate polarity due to the methoxy group, which can enhance solubility in polar solvents. Additionally, the amino group (-NH2) at position 5 can participate in hydrogen bonding, further affecting its interactions in various chemical environments. This compound may be of interest in pharmaceutical research or as a building block in organic synthesis, given the significance of pyrimidine derivatives in medicinal chemistry. However, specific applications and biological activities would require further investigation and context.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-4-6(8)5(2)10-7(9-4)11-3/h8H2,1-3H3
InChI key:InChIKey=VGNLULREMZSULK-UHFFFAOYSA-N
SMILES:O(C)C=1N=C(C)C(N)=C(C)N1
Synonyms:
  • 2-Methoxy-4,6-dimethyl-pyrimidin-5-ylamine
  • 2-Methoxy-4,6-dimethyl-5-pyrimidinamine
  • 5-Pyrimidinamine, 2-methoxy-4,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.