CAS 1174-11-4
:Xenazoic acid
Description:
Xenazoic acid, with the CAS number 1174-11-4, is a chemical compound that belongs to the class of azoles, which are characterized by their nitrogen-containing heterocyclic structures. This compound is notable for its unique molecular framework, which contributes to its distinct chemical properties. Xenazoic acid typically exhibits acidic behavior due to the presence of carboxylic acid functional groups, allowing it to donate protons in solution. Its structure may also include various substituents that can influence its reactivity and solubility in different solvents. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in creating novel materials or as an intermediate in chemical reactions. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, may vary and should be referenced from reliable chemical databases or literature for precise information. As with many chemical substances, safety data sheets should be consulted to understand its handling and potential hazards.
Formula:C23H21NO4
InChI:InChI=1S/C23H21NO4/c1-2-28-22(24-20-14-12-19(13-15-20)23(26)27)21(25)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-15,22,24H,2H2,1H3,(H,26,27)
InChI key:InChIKey=BPOMPTVRBWXZBY-UHFFFAOYSA-N
SMILES:C(C(NC1=CC=C(C(O)=O)C=C1)OCC)(=O)C2=CC=C(C=C2)C3=CC=CC=C3
Synonyms:- 4-[(2-[1,1′-Biphenyl]-4-yl-1-ethoxy-2-oxoethyl)amino]benzoic acid
- 4-{[2-(Biphenyl-4-Yl)-1-Ethoxy-2-Oxoethyl]Amino}Benzoic Acid
- Benzoic acid, 4-[(2-[1,1′-biphenyl]-4-yl-1-ethoxy-2-oxoethyl)amino]-
- Benzoic acid, p-[(α-ethoxy-p-phenylphenacyl)amino]-
- Cv 58903
- NSC 43842
- NSC 58991
- NSC 59182
- Skf 8318
- Xanalamine
- Xenalamine
- Xenovis
- p-[(alpha-Ethoxy-p-phenylphenacyl)amino]benzoic acid
- p-[(α-Ethoxy-p-phenylphenacyl)amino]benzoic acid
- Benzoic acid, p-[ (.alpha.-ethoxy-p-phenylphenacyl)amino]-
- 4-[[1-ethoxy-2-keto-2-(4-phenylphenyl)ethyl]amino]benzoic acid
- 4-[[1-ethoxy-2-oxo-2-(4-phenylphenyl)ethyl]amino]benzoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Xenazoic Acid
CAS:Controlled ProductStability Temperature sensitive
Applications Xenazoic Acid has been identified in virtual screening against TRβ agonist binding pocket.
References Campagna-Slater, V., Schapira, M.: J. Chem. Infor. Modeling, 49, 2082 (2009)Formula:C23H21NO4Color and Shape:NeatMolecular weight:375.42Xenalamine
CAS:Xenalamine is a synthetic compound of antiviral.Formula:C23H21NO4Purity:98%Color and Shape:SolidMolecular weight:375.42


