
CAS 1174-83-0
:Phosphorothioic acid, O,O′-(sulfonyldi-4,1-phenylene) O,O,O′,O′-tetramethyl ester
Description:
Phosphorothioic acid, O,O′-(sulfonyldi-4,1-phenylene) O,O,O′,O′-tetramethyl ester, commonly known by its CAS number 1174-83-0, is an organophosphorus compound characterized by its complex structure that includes a phosphorothioate moiety. This substance features a sulfonyl group linked to a phenylene unit, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. The compound exhibits moderate to high toxicity, primarily due to its potential to inhibit acetylcholinesterase, an essential enzyme in the nervous system. As a result, it is often studied for its applications in agriculture as a pesticide or insecticide. Additionally, its chemical stability and reactivity make it of interest in various synthetic processes. Proper handling and safety precautions are essential when working with this compound due to its hazardous nature. Overall, its distinctive chemical structure and biological activity make it a significant subject of research in both environmental and health sciences.
Formula:C16H20O8P2S3
InChI:InChI=1S/C16H20O8P2S3/c1-19-25(27,20-2)23-13-5-9-15(10-6-13)29(17,18)16-11-7-14(8-12-16)24-26(28,21-3)22-4/h5-12H,1-4H3
InChI key:InChIKey=ZFHDDQUVNSDLLJ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(OP(OC)(OC)=S)C=C1)C2=CC=C(OP(OC)(OC)=S)C=C2
Synonyms:- Phosphorothioic acid, O,O′-(sulfonyldi-4,1-phenylene) O,O,O′,O′-tetramethyl ester
- Phenol, 4,4′-sulfonyldi-, O,O-diester with O,O-dimethyl phosphorothioate
- Phosphorothioic acid, O,O′-(sulfonyldi-p-phenylene) O,O,O′,O′-tetramethyl ester
- Phenol, 4,4′-sulfonyldi-, bis(O,O-dimethyl phosphorothioate)
- Phosphorothioic acid, O,O-dimethyl ester, O,O-diester with 4,4′-sulfonyldiphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
