CAS 1174005-83-4

2-Bromo-5-nitro-4-(trifluoromethoxy)benzenamine

Description:

2-Bromo-5-nitro-4-(trifluoromethoxy)benzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a trifluoromethoxy substituent on a benzene ring. This compound features a primary amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and stability. The trifluoromethoxy group enhances lipophilicity and can affect the compound's solubility in organic solvents. Additionally, the bromine atom can serve as a potential site for further functionalization. This compound may be of interest in pharmaceutical and agrochemical research due to its unique electronic and steric properties, which can impact biological activity. Overall, 2-Bromo-5-nitro-4-(trifluoromethoxy)benzenamine is a versatile molecule with potential applications in various fields of chemistry.

Formula: C₇H₄BrF₃N₂O₃

InChI: InChI=1S/C7H4BrF3N2O3/c8-3-1-6(16-7(9,10)11)5(13(14)15)2-4(3)12/h1-2H,12H2

InChI key: InChIKey=YZMYNIDWJGKAQL-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(N(=O)=O)C=C(N)C(Br)=C1

Synonyms:

• Benzenamine, 2-bromo-5-nitro-4-(trifluoromethoxy)-
• 2-Bromo-5-nitro-4-(trifluoromethoxy)benzenamine
• 2-Bromo-5-nitro-4-trifluoromethoxyaniline