CymitQuimica logo

CAS 1174005-85-6

:

2,3-Difluoro-4-propoxybenzonitrile

Description:
2,3-Difluoro-4-propoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a propoxy group, as well as a nitrile functional group. The presence of the difluoro substituents indicates that the compound may exhibit unique electronic properties, potentially influencing its reactivity and interaction with other molecules. The propoxy group contributes to the compound's hydrophobic characteristics, which can affect its solubility in various solvents. The nitrile group, characterized by the presence of a carbon triple-bonded to a nitrogen atom, adds to the compound's polarity and can participate in hydrogen bonding. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or referenced from reliable chemical databases.
Formula:C10H9F2NO
InChI:InChI=1S/C10H9F2NO/c1-2-5-14-8-4-3-7(6-13)9(11)10(8)12/h3-4H,2,5H2,1H3
InChI key:InChIKey=GFPDFECBLJOVLW-UHFFFAOYSA-N
SMILES:O(CCC)C1=C(F)C(F)=C(C#N)C=C1
Synonyms:
  • 2,3-Difluoro-4-propoxybenzonitrile
  • Benzonitrile, 2,3-difluoro-4-propoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.