
CAS 1174006-45-1
:6,6′′-[(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis(1,3,4-oxadiazole-5,2-diyl)]bis[2,2′-bipyridine]
Description:
The chemical substance known as "6,6′′-[(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis(1,3,4-oxadiazole-5,2-diyl)]bis[2,2′-bipyridine]" is a complex organic compound characterized by its unique structural features, which include a fluorene core and multiple heterocyclic units. The presence of the 1,3,4-oxadiazole moieties contributes to its potential as a building block in materials science, particularly in the development of organic semiconductors and luminescent materials. The bipyridine units can facilitate coordination with metal ions, making this compound of interest in coordination chemistry and catalysis. Its molecular structure suggests potential applications in organic electronics, such as light-emitting diodes (OLEDs) and photovoltaic devices, due to its ability to exhibit charge transport properties. Additionally, the dimethyl substitution on the fluorene enhances its solubility and stability, which are critical for practical applications. Overall, this compound exemplifies the intersection of organic synthesis and materials chemistry, showcasing the versatility of heterocyclic compounds in advanced technological applications.
Formula:C39H26N8O2
InChI:InChI=1S/C39H26N8O2/c1-39(2)27-21-23(35-44-46-37(48-35)33-13-7-11-31(42-33)29-9-3-5-19-40-29)15-17-25(27)26-18-16-24(22-28(26)39)36-45-47-38(49-36)34-14-8-12-32(43-34)30-10-4-6-20-41-30/h3-22H,1-2H3
InChI key:InChIKey=RYTUDCZDAVNDOI-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(C=3C1=CC(=CC3)C=4OC(=NN4)C=5N=C(C=CC5)C6=CC=CC=N6)=CC=C(C2)C=7OC(=NN7)C=8N=C(C=CC8)C9=CC=CC=N9
Synonyms:- 2,7-Bis[2-(2,2′-bipyridin-6-yl)-1,3,4-oxadiazol-5-yl]-9,9-dimethylfluorene
- 6,6′′-[(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis(1,3,4-oxadiazole-5,2-diyl)]bis[2,2′-bipyridine]
- 2,2′-Bipyridine, 6,6′′-[(9,9-dimethyl-9H-fluorene-2,7-diyl)bis(1,3,4-oxadiazole-5,2-diyl)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.