CymitQuimica logo

CAS 1174013-25-2

:

Methyl (αR)-α-[[(trifluoromethyl)sulfonyl]oxy]cyclopentanepropanoate

Description:
Methyl (αR)-α-[[(trifluoromethyl)sulfonyl]oxy]cyclopentanepropanoate is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a trifluoromethylsulfonyl group. This compound is typically classified as an ester due to the presence of the propanoate moiety. The trifluoromethylsulfonyl group imparts significant polarity and can enhance the compound's reactivity, making it useful in various synthetic applications. The stereochemistry indicated by the (αR) designation suggests that the compound has a specific spatial arrangement of its atoms, which can influence its biological activity and interaction with other molecules. Methyl (αR)-α-[[(trifluoromethyl)sulfonyl]oxy]cyclopentanepropanoate may exhibit properties such as solubility in organic solvents and potential applications in medicinal chemistry or agrochemicals. Its unique functional groups may also contribute to its potential as a reagent in organic synthesis, particularly in the formation of more complex molecules. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties compared to non-fluorinated analogs.
Formula:C10H15F3O5S
InChI:InChI=1S/C10H15F3O5S/c1-17-9(14)8(6-7-4-2-3-5-7)18-19(15,16)10(11,12)13/h7-8H,2-6H2,1H3/t8-/m1/s1
InChI key:InChIKey=LLEAPZQEGKSDNL-MRVPVSSYSA-N
SMILES:[C@@H](OS(C(F)(F)F)(=O)=O)(CC1CCCC1)C(OC)=O
Synonyms:
  • Cyclopentanepropanoic acid, α-[[(trifluoromethyl)sulfonyl]oxy]-, methyl ester, (αR)-
  • Methyl (αR)-α-[[(trifluoromethyl)sulfonyl]oxy]cyclopentanepropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.