CAS 117402-89-8

3,4-Dichloro-N-[(phenylmethoxy)carbonyl]-D-phenylalanine

Description:

3,4-Dichloro-N-[(phenylmethoxy)carbonyl]-D-phenylalanine, identified by its CAS number 117402-89-8, is a synthetic amino acid derivative that features a dichloro substitution on the aromatic ring and a phenylmethoxycarbonyl group. This compound is characterized by its structural complexity, which includes a chiral center, making it an important molecule in pharmaceutical research, particularly in the development of peptide-based drugs. The presence of the dichloro substituents enhances its biological activity and may influence its interaction with biological targets. The phenylmethoxycarbonyl group serves as a protective moiety, which can be crucial for stability and solubility in various solvents. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the design of inhibitors or modulators of specific biological pathways. Its unique structure allows for various modifications, making it a versatile building block in organic synthesis and drug development. As with many chemical substances, safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₇H₁₅Cl₂NO₄

InChI: InChI=1S/C17H15Cl2NO4/c18-13-7-6-12(8-14(13)19)9-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,23)(H,21,22)/t15-/m1/s1

InChI key: InChIKey=OCSKWTVJNRBFAQ-OAHLLOKOSA-N

SMILES: C([C@@H](NC(OCC1=CC=CC=C1)=O)C(O)=O)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 3,4-Dichloro-N-[(phenylmethoxy)carbonyl]-D-phenylalanine
• D-Phenylalanine, 3,4-dichloro-N-[(phenylmethoxy)carbonyl]-

D-Phenylalanine, 3,4-dichloro-N-[(phenylmethoxy)carbonyl]-

CAS: 117402-89-8

Formula: C₁₇H₁₅Cl₂NO₄

Molecular weight: 368.2113

Ref: IN-DA000E8O