CAS 1174029-29-8

Benzenamine, 4-bromo-2-fluoro-, hydrochloride (1:1)

Description:

Benzenamine, 4-bromo-2-fluoro-, hydrochloride (1:1) is an organic compound characterized by the presence of a benzene ring substituted with both a bromine atom and a fluorine atom, along with an amino group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound typically exhibits properties associated with aromatic amines, such as potential reactivity in electrophilic substitution reactions due to the electron-donating nature of the amino group. The presence of halogen substituents (bromine and fluorine) can influence the compound's reactivity, polarity, and overall stability. Additionally, the hydrochloride form may affect its biological activity and pharmacokinetics, making it relevant in medicinal chemistry. Safety considerations are important, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound's unique structure and properties make it of interest in various fields, including pharmaceuticals and materials science.

Formula: C₆H₅BrFN·ClH

InChI: InChI=1S/C6H5BrFN.ClH/c7-4-1-2-6(9)5(8)3-4;/h1-3H,9H2;1H

InChI key: InChIKey=SAIDHIHJVZUPGX-UHFFFAOYSA-N

SMILES: FC1=C(N)C=CC(Br)=C1.Cl

Synonyms:

• Benzenamine, 4-bromo-2-fluoro-, hydrochloride (1:1)

Benzenamine, 4-bromo-2-fluoro-, hydrochloride (1:1)

CAS: 1174029-29-8

Formula: C₆H₆BrClFN

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.4739

Ref: IN-DA000E9B

4-Bromo-2-fluoroaniline hydrochloride

CAS: 1174029-29-8

4-Bromo-2-fluoroaniline hydrochloride

Purity: 97%

Molecular weight: 226.47g/mol

Ref: 54-PC5220

4-Bromo-2-fluoroaniline hydrochloride

CAS: 1174029-29-8

4-Bromo-2-fluoroaniline hydrochloride is a versatile building block that can be used as a reactant, reagent, or service scaffold. It has been widely used in the synthesis of complex compounds and fine chemicals. The CAS number for 4-Bromo-2-fluoroaniline hydrochloride is 1174029-29-8.

Formula: C₆H₅BrFN•HCl

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 226.47 g/mol

Ref: 3D-FB67811

4-BROMO-2-FLUOROANILINE HCL

CAS: 1174029-29-8

Formula: C₆H₆BrClFN

Purity: 95%

Molecular weight: 226.47

Ref: 10-F467246