CymitQuimica logo

CAS 1174047-06-3

:

2,3-Dichloropyridin-4-ylol

Description:
2,3-Dichloropyridin-4-ylol, identified by its CAS number 1174047-06-3, is a chemical compound that features a pyridine ring substituted with two chlorine atoms and a hydroxyl group. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The dichlorination at the 2 and 3 positions of the pyridine ring enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, 2,3-Dichloropyridin-4-ylol represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C5H3Cl2NO
InChI:InChI=1S/C5H3Cl2NO/c6-4-3(9)1-2-8-5(4)7/h1-2H,(H,8,9)
InChI key:OIIQOSKJOINELL-UHFFFAOYSA-N
SMILES:C1=CNC(=C(C1=O)Cl)Cl
Found 5 products.