CAS 1174069-03-4

1,1-Dimethylethyl 3-formyl-5,6-dihydro-1,2,4-triazolo[4,3-a]pyrazine-7(8H)-carboxylate

Description:

1,1-Dimethylethyl 3-formyl-5,6-dihydro-1,2,4-triazolo[4,3-a]pyrazine-7(8H)-carboxylate is a complex organic compound characterized by its unique structural features, which include a triazole and pyrazine ring system. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of functional groups like the formyl and carboxylate moieties. The presence of the dimethyl group contributes to its steric properties, potentially influencing its solubility and interaction with biological targets. As a member of the triazole family, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry, with potential applications in drug development and other chemical industries.

Formula: C₁₁H₁₆N₄O₃

InChI: InChI=1S/C11H16N4O3/c1-11(2,3)18-10(17)14-4-5-15-8(6-14)12-13-9(15)7-16/h7H,4-6H2,1-3H3

InChI key: InChIKey=SURBHXJZUCWWOG-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(CN(C(OC(C)(C)C)=O)CC2)=NN1

Synonyms:

• 1,1-Dimethylethyl 3-formyl-5,6-dihydro-1,2,4-triazolo[4,3-a]pyrazine-7(8H)-carboxylate
• 1,2,4-Triazolo[4,3-a]pyrazine-7(8H)-carboxylic acid, 3-formyl-5,6-dihydro-, 1,1-dimethylethyl ester

tert-butyl 3-formyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate

CAS: 1174069-03-4

Formula: C₁₁H₁₆N₄O₃

Molecular weight: 252.2697

Ref: IN-DA000E9L

tert-Butyl 3-formyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-α]pyrazine-7-carboxylate

CAS: 1174069-03-4

Tert-butyl 3-formyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-α]pyrazine-7-carboxylate is a research chemical that is used as a building block in the synthesis of complex compounds. It is also used as a reagent and a speciality chemical. Tert-butyl 3-formyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-α]pyrazine-7-carboxylate is an intermediate in the synthesis of other chemicals with high quality and versatile building blocks. It has been used in reactions to produce various heterocycles including 1-(2'-aminophenoxy)propane hydrochloride.

Formula: C₁₁H₁₆N₄O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 252.27 g/mol

Ref: 3D-ZWB06903