CAS 117420-82-3
:5-[(4-Methylphenyl)sulfonyl]-2-(methylthio)-4-thiazolamine
Description:
5-[(4-Methylphenyl)sulfonyl]-2-(methylthio)-4-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a sulfonyl group attached to a para-methylphenyl moiety, enhancing its lipophilicity and potential biological activity. The presence of a methylthio group contributes to its overall reactivity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the thiazole structure can lead to varied biological effects. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific enzymes or receptors. Additionally, the sulfonamide functional group is known for its role in various therapeutic agents, further indicating the compound's relevance in pharmaceutical research. As with many thiazole derivatives, the compound may exhibit antimicrobial, anti-inflammatory, or anticancer properties, warranting further investigation into its biological efficacy and safety profile.
Formula:C11H12N2O2S3
InChI:InChI=1S/C11H12N2O2S3/c1-7-3-5-8(6-4-7)18(14,15)10-9(12)13-11(16-2)17-10/h3-6H,12H2,1-2H3
InChI key:InChIKey=UIQFJTVXRNTXAR-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1SC(SC)=NC1N)C2=CC=C(C)C=C2
Synonyms:- 4-Thiazolamine, 5-[(4-methylphenyl)sulfonyl]-2-(methylthio)-
- 5-[(4-Methylphenyl)sulfonyl]-2-(methylthio)-4-thiazolamine
- 2-(Methylthio)-5-tosylthiazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
