CAS 1174207-80-7

1-[1-(Phenylmethyl)-1H-pyrazol-4-yl]piperazine

Description:

1-[1-(Phenylmethyl)-1H-pyrazol-4-yl]piperazine is a chemical compound characterized by its unique structural features, which include a piperazine ring and a pyrazole moiety substituted with a phenylmethyl group. This compound typically exhibits properties associated with both piperazine and pyrazole derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the piperazine ring often contributes to its ability to interact with various biological targets, potentially influencing neurotransmitter systems. The phenylmethyl group can enhance lipophilicity, affecting the compound's solubility and permeability. Additionally, the pyrazole ring may impart specific reactivity and stability characteristics, influencing its behavior in chemical reactions. Overall, this compound's structural complexity suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its potential applications.

Formula: C₁₄H₁₈N₄

InChI: InChI=1S/C14H18N4/c1-2-4-13(5-3-1)11-18-12-14(10-16-18)17-8-6-15-7-9-17/h1-5,10,12,15H,6-9,11H2

InChI key: InChIKey=PAJNMLFSNZAQAG-UHFFFAOYSA-N

SMILES: C(N1C=C(C=N1)N2CCNCC2)C3=CC=CC=C3

Synonyms:

• Piperazine, 1-[1-(phenylmethyl)-1H-pyrazol-4-yl]-
• 1-(1-Benzyl-1H-pyrazol-4-yl)piperazine
• 1-[1-(Phenylmethyl)-1H-pyrazol-4-yl]piperazine