CAS 117422-50-1
:(3S)-3,4-dihydro-5-methoxy-2H-1-Benzopyran-3-amine
Description:
(3S)-3,4-dihydro-5-methoxy-2H-1-benzopyran-3-amine, with the CAS number 117422-50-1, is a chemical compound characterized by its benzopyran structure, which consists of a fused benzene and pyran ring. This compound features a methoxy group (-OCH3) at the 5-position and an amine group (-NH2) at the 3-position, contributing to its potential biological activity. The stereochemistry indicated by the (3S) designation suggests that the compound has a specific three-dimensional arrangement, which can influence its interactions with biological targets. The presence of the dihydro group indicates that the compound is partially saturated, which may affect its reactivity and stability. Such compounds are often studied for their pharmacological properties, including potential antioxidant, anti-inflammatory, or neuroprotective effects. The unique combination of functional groups and structural features makes this compound of interest in medicinal chemistry and drug development. Further research is necessary to fully elucidate its properties and potential applications.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-12-9-3-2-4-10-8(9)5-7(11)6-13-10/h2-4,7H,5-6,11H2,1H3/t7-/m0/s1
SMILES:COc1cccc2c1C[C@@H](CO2)N
Synonyms:- (S)-5-methoxychroman-3-amine
- (3S)-5-methoxy-3,4-dihydro-2H-chromen-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
