CAS 117423-41-3

4-(TERT-BUTYLDIMETHYLSILYLOXYMETHYL)PYRIDINE

Description:

4-(Tert-butyldimethylsilyloxy)methylpyridine is an organic compound characterized by the presence of a pyridine ring substituted with a tert-butyldimethylsilyloxy group. This compound typically exhibits properties associated with both pyridine derivatives and silyl ethers. The tert-butyldimethylsilyloxy group enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in chemical reactions. The presence of the pyridine moiety contributes to its basicity and potential reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the compound may exhibit unique spectroscopic characteristics, such as distinct NMR and IR signals, due to the functional groups present. Its applications can extend to medicinal chemistry and materials science, where it may serve as an intermediate or a building block for more complex molecules. Overall, 4-(tert-butyldimethylsilyloxy)methylpyridine is a versatile compound with significant utility in synthetic organic chemistry.

Formula: C₁₂H₂₁NOSi

InChI: InChI=1/C12H21NOSi/c1-12(2,3)15(4,5)14-10-11-6-8-13-9-7-11/h6-9H,10H2,1-5H3

SMILES: CC(C)(C)[Si](C)(C)OCc1ccncc1

Synonyms:

• Akos 91359
• 4-({[Tert-Butyl(Dimethyl)Silyl]Oxy}Methyl)Pyridine

Pyridine, 4-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-

CAS: 117423-41-3

Formula: C₁₂H₂₁NOSi

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.3867

Ref: IN-DA000EAB

4-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRIDINE

CAS: 117423-41-3

Formula: C₁₂H₂₁NOSi

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 223.391

Ref: 10-F306337

4-(tert-Butyldimethylsilyloxymethyl)pyridine

CAS: 117423-41-3

4-(tert-Butyldimethylsilyloxymethyl)pyridine is a reagent that is used to prepare stoichiometric quantities of triethyloxonium ions in the presence of catalytic amounts of palladium. 4-(tert-Butyldimethylsilyloxymethyl)pyridine is also used as an anticancer agent, which may be due to its ability to inhibit cell proliferation and induce apoptosis. This compound has been shown to prevent the growth of micellar structures and reduce the rate of ester hydrolysis. It also has the ability to convert into two enantiomers, one with a hydroxyl group on the methylene carbon at position 4 and another with an alcohol group on this same carbon.

Formula: C₁₂H₂₁NOSi

Purity: Min. 95%

Color and Shape: Yellow Liquid

Molecular weight: 223.39 g/mol

Ref: 3D-FB19567